People | Locations | Statistics |
---|---|---|
Naji, M. |
| |
Motta, Antonella |
| |
Aletan, Dirar |
| |
Mohamed, Tarek |
| |
Ertürk, Emre |
| |
Taccardi, Nicola |
| |
Kononenko, Denys |
| |
Petrov, R. H. | Madrid |
|
Alshaaer, Mazen | Brussels |
|
Bih, L. |
| |
Casati, R. |
| |
Muller, Hermance |
| |
Kočí, Jan | Prague |
|
Šuljagić, Marija |
| |
Kalteremidou, Kalliopi-Artemi | Brussels |
|
Azam, Siraj |
| |
Ospanova, Alyiya |
| |
Blanpain, Bart |
| |
Ali, M. A. |
| |
Popa, V. |
| |
Rančić, M. |
| |
Ollier, Nadège |
| |
Azevedo, Nuno Monteiro |
| |
Landes, Michael |
| |
Rignanese, Gian-Marco |
|
Andre, G.
in Cooperation with on an Cooperation-Score of 37%
Topics
Publications (6/6 displayed)
- 2016Low temperature magneto-structural transitions in Mn3Ni20P6citations
- 2011Antiferromagnetic order and consequences on the transport properties of Ba4Ru3O10citations
- 2009Effect of Nonmagnetic Substituents Mg and Zn on the Phase Competition in the Multiferroic Antiferromagnet MnWO 4citations
- 2008Magnetic ordering and spin structure in Ca-bearing clinopyroxenes CaM$^{2+}$(Si, Ge)$_2$O$_6$, M = Fe, Ni, Co, Mncitations
- 2006Magnetic structure and magnetic properties of synthetic lindgrenite, Cu-3(OH)(2)(MoO4)(2)citations
- 2006Nuclear and magnetic structures and magnetic properties of the layered cobalt hydroxysulfate Co-5(OH)(6)(SO4)(2)(H2O)(4) and its deuterated analogue, Co-5(OD)(6)(SO4)(2)(D2O)citations
Places of action
Organizations | Location | People |
---|