693.932 PEOPLE
| People | Locations | Statistics |
|---|---|---|
| Naji, M. |
| |
| Motta, Antonella |
| |
| Aletan, Dirar |
| |
| Mohamed, Tarek |
| |
| Ertürk, Emre |
| |
| Taccardi, Nicola |
| |
| Kononenko, Denys |
| |
| Petrov, R. H. | Madrid |
|
| Alshaaer, Mazen | Brussels |
|
| Bih, L. |
| |
| Casati, R. |
| |
| Muller, Hermance |
| |
| Kočí, Jan | Prague |
|
| Šuljagić, Marija |
| |
| Kalteremidou, Kalliopi-Artemi | Brussels |
|
| Azam, Siraj |
| |
| Ospanova, Alyiya |
| |
| Blanpain, Bart |
| |
| Ali, M. A. |
| |
| Popa, V. |
| |
| Rančić, M. |
| |
| Ollier, Nadège |
| |
| Azevedo, Nuno Monteiro |
| |
| Landes, Michael |
| |
| Rignanese, Gian-Marco |
|
Camara, F.
in Cooperation with on an Cooperation-Score of 37%
Topics
Publications (8/8 displayed)
- 2024Raman scattering of omphacite at high pressure: toward its possible application to elastic geothermobarometrycitations
- 2024Cation order in omphacitic clinopyroxenes: implications for Raman elastic geothermobarometry
- 2021The crystal structure of Na2CaAl4O8 and its hydration behaviourcitations
- 2021Zinkgruvanite, Ba4Mn2+4Fe3+2(Si2O7)2(SO4)2O2(OH)2, a new ericssonite-group mineral from the Zinkgruvan Zn-Pb-Ag-Cu deposit, Askersund, Örebro County, Swedencitations
- 2019Thermodynamics, elasticity and phase stability of grossite (CaAl4O7) at high pressure and temperature
- 2012Kircherite, a new mineral of the cancrinite-sodalite group with a 36-layer stacking sequence : occurrence and crystal structurecitations
- 2010Fantappièite, a new mineral of the cancrinite-sodalite group with a 33-layer stacking sequence : occurrence and crystal structurecitations
- 2002The high-temperature P2(1)/c-C2/c phase transition in Fe-free pyroxene (Ca0.15Mg1.85Si2O6) : structural and thermodynamic behaviorcitations
Places of action
| Organizations | Location | People |
|---|