People | Locations | Statistics |
---|---|---|
Naji, M. |
| |
Motta, Antonella |
| |
Aletan, Dirar |
| |
Mohamed, Tarek |
| |
Ertürk, Emre |
| |
Taccardi, Nicola |
| |
Kononenko, Denys |
| |
Petrov, R. H. | Madrid |
|
Alshaaer, Mazen | Brussels |
|
Bih, L. |
| |
Casati, R. |
| |
Muller, Hermance |
| |
Kočí, Jan | Prague |
|
Šuljagić, Marija |
| |
Kalteremidou, Kalliopi-Artemi | Brussels |
|
Azam, Siraj |
| |
Ospanova, Alyiya |
| |
Blanpain, Bart |
| |
Ali, M. A. |
| |
Popa, V. |
| |
Rančić, M. |
| |
Ollier, Nadège |
| |
Azevedo, Nuno Monteiro |
| |
Landes, Michael |
| |
Rignanese, Gian-Marco |
|
Patel, B.
in Cooperation with on an Cooperation-Score of 37%
Topics
Publications (3/3 displayed)
- 2012Cobalt-based orthopaedic alloys: Relationship between forming route, microstructure and tribological performance
- 2012Novel Processing, Microstructure and Properties of a Cobalt-Chromium-Molybdenum Orthopaedic Alloy
- 2001Silver(I) complexes with the mixed P/O donor ligand Ph2P(CH2)(2)O(CH2)(2)O(CH2)(2)PPh2 (L-1) and the crystal structures of Ag(L-1) (CF3SO3), Ag-2(L-1)(3) (CF3SO3)(2) and Ag(L-1)(NO3)citations
Places of action
Organizations | Location | People |
---|