People | Locations | Statistics |
---|---|---|
Naji, M. |
| |
Motta, Antonella |
| |
Aletan, Dirar |
| |
Mohamed, Tarek |
| |
Ertürk, Emre |
| |
Taccardi, Nicola |
| |
Kononenko, Denys |
| |
Petrov, R. H. | Madrid |
|
Alshaaer, Mazen | Brussels |
|
Bih, L. |
| |
Casati, R. |
| |
Muller, Hermance |
| |
Kočí, Jan | Prague |
|
Šuljagić, Marija |
| |
Kalteremidou, Kalliopi-Artemi | Brussels |
|
Azam, Siraj |
| |
Ospanova, Alyiya |
| |
Blanpain, Bart |
| |
Ali, M. A. |
| |
Popa, V. |
| |
Rančić, M. |
| |
Ollier, Nadège |
| |
Azevedo, Nuno Monteiro |
| |
Landes, Michael |
| |
Rignanese, Gian-Marco |
|
Ptak, Maciej
in Cooperation with on an Cooperation-Score of 37%
Topics
Publications (4/4 displayed)
- 2022Mixology of MA1- xEAxPbI3Hybrid Perovskitescitations
- 2020Effect of alkali and trivalent metal ions on the high-pressure phase transition of [C 2 H 5 NH 3 ]M I 0.5 M III 0.5 (HCOO) 3 (M I = Na, K and M III = Cr, Al) heterometallic perovskitescitations
- 2019Pressure-enhanced ferroelectric polarisation in a polar perovskite-like [C2H5NH3]Na0.5Cr0.5(HCOO)3 metal-organic frameworkcitations
- 2018Heterometallic perovskite-type metal-organic framework with an ammonium cation: structure, phonons, and optical response of [NH 4 ]Na 0.5 Cr x Al 0.5-x (HCOO) 3 (x=0, 0.025 and 0.5)citations
Places of action
Organizations | Location | People |
---|