693.932 PEOPLE
| People | Locations | Statistics |
|---|---|---|
| Naji, M. |
| |
| Motta, Antonella |
| |
| Aletan, Dirar |
| |
| Mohamed, Tarek |
| |
| Ertürk, Emre |
| |
| Taccardi, Nicola |
| |
| Kononenko, Denys |
| |
| Petrov, R. H. | Madrid |
|
| Alshaaer, Mazen | Brussels |
|
| Bih, L. |
| |
| Casati, R. |
| |
| Muller, Hermance |
| |
| Kočí, Jan | Prague |
|
| Šuljagić, Marija |
| |
| Kalteremidou, Kalliopi-Artemi | Brussels |
|
| Azam, Siraj |
| |
| Ospanova, Alyiya |
| |
| Blanpain, Bart |
| |
| Ali, M. A. |
| |
| Popa, V. |
| |
| Rančić, M. |
| |
| Ollier, Nadège |
| |
| Azevedo, Nuno Monteiro |
| |
| Landes, Michael |
| |
| Rignanese, Gian-Marco |
|
Janolin, Pierre-Eymeric
CentraleSupélec
in Cooperation with on an Cooperation-Score of 37%
Topics
Publications (11/11 displayed)
- 2022Data-driven methods for discovery of next-generation electrostrictive materialscitations
- 2022Data-driven methods for discovery of next-generation electrostrictive materialscitations
- 2020Skewed electronic band structure induced by electric polarization in ferroelectric BaTiO3citations
- 2020Electrically driven transient and permanent phase transformations in highly strained epitaxial BiFeO3 thin filmscitations
- 2016Superconductivity and Ferroelectricity
- 2015Original Reaction Sequence of Pb(Yb1/2Nb1/2)O3-PbTiO3: Consequences on Dielectric Properties and Chemical Ordercitations
- 2015Original Reaction Sequence of Pb(Yb 1/2 Nb 1/2 )O 3 -PbTiO 3 :Consequences on dielectric properties and chemical ordercitations
- 2015Original Reaction Sequence of Pb(Yb1/2Nb1/2)O-3-PbTiO3: Consequences on Dielectric Properties and Chemical Ordercitations
- 2015Original Reaction Sequence of Pb(Yb1/2Nb1/2)O-3-PbTiO3: Consequences on Dielectric Properties and Chemical Ordercitations
- 2015Ferroelectricity and weak ferromagnetism of hexagonal ErFeO 3 thin filmscitations
- 2009Strain on ferroelectric thin films ; Strain on ferroelectric thin films: Example of Pb(Zr1−xTix)O3citations
Places of action
| Organizations | Location | People |
|---|