693.932 PEOPLE
| People | Locations | Statistics |
|---|---|---|
| Naji, M. |
| |
| Motta, Antonella |
| |
| Aletan, Dirar |
| |
| Mohamed, Tarek |
| |
| Ertürk, Emre |
| |
| Taccardi, Nicola |
| |
| Kononenko, Denys |
| |
| Petrov, R. H. | Madrid |
|
| Alshaaer, Mazen | Brussels |
|
| Bih, L. |
| |
| Casati, R. |
| |
| Muller, Hermance |
| |
| Kočí, Jan | Prague |
|
| Šuljagić, Marija |
| |
| Kalteremidou, Kalliopi-Artemi | Brussels |
|
| Azam, Siraj |
| |
| Ospanova, Alyiya |
| |
| Blanpain, Bart |
| |
| Ali, M. A. |
| |
| Popa, V. |
| |
| Rančić, M. |
| |
| Ollier, Nadège |
| |
| Azevedo, Nuno Monteiro |
| |
| Landes, Michael |
| |
| Rignanese, Gian-Marco |
|
Richard-Plouet, Mireille
French National Centre for Scientific Research
in Cooperation with on an Cooperation-Score of 37%
Topics
Publications (16/16 displayed)
- 2024Control of microstructure and composition of reactively sputtered vanadium nitride thin films based on hysteresis curves and application to microsupercapacitorscitations
- 2023Comprehensive study of WSiC:H coatings synthesized by microwave-assisted RF reactive sputteringcitations
- 2022Flow stress improvement of a nickel multicrystal by physical vapor thin film deposition to reduce surface effects
- 2022Kinetics driving nanocomposite thin-film deposition in low-pressure misty plasma processescitations
- 2021Hybrid approaches coupling sol–gel and plasma for the deposition of oxide-based nanocomposite thin films: a reviewcitations
- 2020Modification of the optical properties and nano-crystallinity of anatase TiO2nanoparticles thin film using low pressure O2 plasma treatmentcitations
- 2018Stress Gradient Determination in Anti-Corrosion Multilayer Coatingcitations
- 2018Stress Gradient Determination in Anti-Corrosion Multilayer Coatingcitations
- 2014Electrophoretic deposition of BaTiO3 thin films from stable colloidal aqueous solutionscitations
- 2013Anatase colloidal solutions suitable for inkjet printing: Enhancing lifetime of hybrid organic solar cellscitations
- 2012Deposition of nickel oxide by direct current reactive sputtering Effect of oxygen partial pressurecitations
- 2011Optical characterization of transparent nickel oxide films deposited by DC current reactive sputteringcitations
- 2006Magnetic structure and magnetic properties of synthetic lindgrenite, Cu-3(OH)(2)(MoO4)(2)citations
- 2006Comparison of lanthanum substituted bismuth titanate (BLT) thin films deposited by sputtering and pulsed laser depositioncitations
- 2006Nuclear and magnetic structures and magnetic properties of synthetic brochantite, Cu 4 (OH) 6 SO 4citations
- 2006Nuclear and magnetic structures and magnetic properties of the layered cobalt hydroxysulfate Co-5(OH)(6)(SO4)(2)(H2O)(4) and its deuterated analogue, Co-5(OD)(6)(SO4)(2)(D2O)citations
Places of action
| Organizations | Location | People |
|---|