| People | Locations | Statistics |
|---|---|---|
| Naji, M. |
| |
| Motta, Antonella |
| |
| Aletan, Dirar |
| |
| Mohamed, Tarek |
| |
| Ertürk, Emre |
| |
| Taccardi, Nicola |
| |
| Kononenko, Denys |
| |
| Petrov, R. H. | Madrid |
|
| Alshaaer, Mazen | Brussels |
|
| Bih, L. |
| |
| Casati, R. |
| |
| Muller, Hermance |
| |
| Kočí, Jan | Prague |
|
| Šuljagić, Marija |
| |
| Kalteremidou, Kalliopi-Artemi | Brussels |
|
| Azam, Siraj |
| |
| Ospanova, Alyiya |
| |
| Blanpain, Bart |
| |
| Ali, M. A. |
| |
| Popa, V. |
| |
| Rančić, M. |
| |
| Ollier, Nadège |
| |
| Azevedo, Nuno Monteiro |
| |
| Landes, Michael |
| |
| Rignanese, Gian-Marco |
|
Sieradzki, Adam
in Cooperation with on an Cooperation-Score of 37%
Topics
Publications (10/10 displayed)
- 2024Temperature and volumetric effects on structural and dielectric properties of hybrid perovskitescitations
- 2023Thermal Properties of Polymer Adhesive Modified with TiO2 Used for Structural Strengthening
- 2022Three-Dimensional Methylhydrazinium Lead Halide Perovskites: Structural Changes and Effects on Dielectric, Linear, and Nonlinear Optical Properties Entailed by the Halide Tuningcitations
- 2022Controversy on the ferroelectricity in metal–formate frameworkscitations
- 2022Thermal wear of epoxy composite modified with rutile titanium dioxidecitations
- 2022Mixology of MA1- xEAxPbI3Hybrid Perovskitescitations
- 2020Suppression of phase transitions and glass phase signatures in mixed cation halide perovskitescitations
- 2020Three-Dimensional Perovskite Methylhydrazinium Lead Chloride with Two Polar Phases and Unusual Second-Harmonic Generation Bistability above Room Temperaturecitations
- 2019Pressure-enhanced ferroelectric polarisation in a polar perovskite-like [C2H5NH3]Na0.5Cr0.5(HCOO)3 metal-organic frameworkcitations
- 2017Dielectric relaxation and anhydrous proton conduction in [C2H5NH3][Na0.5Fe0.5(HCOO)3] metal-organic frameworkscitations
Places of action
| Organizations | Location | People |
|---|
article
Controversy on the ferroelectricity in metal–formate frameworks
Abstract
<jats:p>The metal–organic frameworks (MOFs) crystallizing in a perovskite-like architecture became extremely interesting for scientists due to a variety of applications including memory devices, energy conversion and drug delivery. These compounds are constructed from a metal–oxygen or metal–nitrogen octahedral coordinated by organic ligands. They exhibit various interesting properties due to their hybrid organic–inorganic nature. However, ferroelectric MOFs still remain scarce and the topic of ferroelectricity raises a lot of controversies. In this article, we will discuss the actual state of knowledge of these specific compounds with a focus on ferroelectric properties. We will try to create an order out of the current confusion that followed attributing ferroelectric properties to metal–formate frameworks without a direct proof.</jats:p>