| People | Locations | Statistics |
|---|---|---|
| Naji, M. |
| |
| Motta, Antonella |
| |
| Aletan, Dirar |
| |
| Mohamed, Tarek |
| |
| Ertürk, Emre |
| |
| Taccardi, Nicola |
| |
| Kononenko, Denys |
| |
| Petrov, R. H. | Madrid |
|
| Alshaaer, Mazen | Brussels |
|
| Bih, L. |
| |
| Casati, R. |
| |
| Muller, Hermance |
| |
| Kočí, Jan | Prague |
|
| Šuljagić, Marija |
| |
| Kalteremidou, Kalliopi-Artemi | Brussels |
|
| Azam, Siraj |
| |
| Ospanova, Alyiya |
| |
| Blanpain, Bart |
| |
| Ali, M. A. |
| |
| Popa, V. |
| |
| Rančić, M. |
| |
| Ollier, Nadège |
| |
| Azevedo, Nuno Monteiro |
| |
| Landes, Michael |
| |
| Rignanese, Gian-Marco |
|
Paraguassu, Waldeci
in Cooperation with on an Cooperation-Score of 37%
Topics
Publications (7/7 displayed)
- 2024Temperature and volumetric effects on structural and dielectric properties of hybrid perovskitescitations
- 2022Pressure-Driven Phase Transition in Two-Dimensional Perovskite MHy2PbBr4citations
- 2022Pressure-Driven Phase Transition in Two-Dimensional Perovskite MHy2PbBr4
- 2020Effect of alkali and trivalent metal ions on the high-pressure phase transition of [C 2 H 5 NH 3 ]M I 0.5 M III 0.5 (HCOO) 3 (M I = Na, K and M III = Cr, Al) heterometallic perovskitescitations
- 2019Pressure-enhanced ferroelectric polarisation in a polar perovskite-like [C2H5NH3]Na0.5Cr0.5(HCOO)3 metal-organic frameworkcitations
- 2018Heterometallic perovskite-type metal-organic framework with an ammonium cation: structure, phonons, and optical response of [NH 4 ]Na 0.5 Cr x Al 0.5-x (HCOO) 3 (x=0, 0.025 and 0.5)citations
- 2017Electrical and Tensile Properties of Carbon Nanotubes-Reinforced Aluminum Alloy 6101 Wirecitations
Places of action
| Organizations | Location | People |
|---|
article
Electrical and Tensile Properties of Carbon Nanotubes-Reinforced Aluminum Alloy 6101 Wire
Abstract
<jats:p>The wires from aluminum alloy 6101 (AA-6101) used in power cables were covered by carbon nanotubes (CNTs) and graphite powders, and then they were subjected to solubilization heat treatment at a temperature of 550 °C and aged at 180 °C. The effects of the processing temperatureon the mechanical and electrical properties of the wires based on CNTs@AA-6101 and graphite@AA-6101 composites were investigated by electron microscopes, thermogravimetric analysis, tensile tests, conductor tests and Raman spectroscopy. The results show that CNTs were successfully incorporatedon the surface of aluminum wires; the tensile strength of CNTs@AA-6101 increased by 30% and 34% as compared to graphite@AA-6101 and standard AA-6101 wire without CNTs, respectively. Moreover, the resistivity had a decrease 13.7% less than conventional wires. The solubilization process addedwith the incorporation of CNTs represents a new way for manufacturing nanostructured power cables to achieve high-performance energy transmission lines.</jats:p>