693.932 PEOPLE
| People | Locations | Statistics |
|---|---|---|
| Naji, M. |
| |
| Motta, Antonella |
| |
| Aletan, Dirar |
| |
| Mohamed, Tarek |
| |
| Ertürk, Emre |
| |
| Taccardi, Nicola |
| |
| Kononenko, Denys |
| |
| Petrov, R. H. | Madrid |
|
| Alshaaer, Mazen | Brussels |
|
| Bih, L. |
| |
| Casati, R. |
| |
| Muller, Hermance |
| |
| Kočí, Jan | Prague |
|
| Šuljagić, Marija |
| |
| Kalteremidou, Kalliopi-Artemi | Brussels |
|
| Azam, Siraj |
| |
| Ospanova, Alyiya |
| |
| Blanpain, Bart |
| |
| Ali, M. A. |
| |
| Popa, V. |
| |
| Rančić, M. |
| |
| Ollier, Nadège |
| |
| Azevedo, Nuno Monteiro |
| |
| Landes, Michael |
| |
| Rignanese, Gian-Marco |
|
Bdikin, Ik
in Cooperation with on an Cooperation-Score of 37%
Topics
Publications (18/18 displayed)
- 2010Local electromechanical properties of ZnO thin films and microcrystals
- 2010Piezoresponse force microscopy studies of the triglycine sulfate-based nanofiberscitations
- 2010Local piezoelectric properties of ZnO thin films prepared by RF-plasma-assisted pulsed-laser deposition methodcitations
- 2009Effect of Gd substitution on the crystal structure and multiferroic properties of BiFeO3citations
- 2009Locally induced charged states in La0.89Sr0.11MnO3 single crystalscitations
- 2009Synthesis and structural characterization of highly < 1 0 0 >-oriented {100}-faceted nanocrystalline diamond films by microwave plasma chemical vapor depositioncitations
- 2009Crystal structure and magnetic properties of Bi-0.8(Gd1-xBax)(0.2)FeO3 (x=0, 0.5, 1) multiferroicscitations
- 2008Crystal structure and multiferroic properties of Gd-substituted BiFeO3citations
- 2008Dynamics of ferroelectric nanodomains in BaTiO3 epitaxial thin films via piezoresponse force microscopycitations
- 2008Domain dynamics in piezoresponse force spectroscopy: Quantitative deconvolution and hysteresis loop fine structurecitations
- 2007Nanoscale characterization of polycrystalline ferroelectric materials for piezoelectric applicationscitations
- 2007Nanoscale polarization patterning of ferroelectric Langmuir-Blodgett P(VDF-TrFE) filmscitations
- 2007Anomalous polarization inversion in ferroelectrics via scanning force microscopycitations
- 2006Growth, crystal structure and stability of Ag-Ni/Cu films
- 2004Nanoscale ferroelectric properties of PZN-PT single crystals studied by scanning force microscopy
- 2004Frequency-dependent electromechanical response in ferroelectric materials measured via piezoresponse force microscopy
- 2004Ferroelectric domain structure and local piezoelectric properties of sol-gel derived Pb(Zr1-xTix)O-3 films
- 2003Nanoscale domains and local piezoelectric hysteresis in Pb(Zn1/3Nb2/3)O-3-4.5%PbTIO3 single crystalscitations
Places of action
| Organizations | Location | People |
|---|
article