| People | Locations | Statistics |
|---|---|---|
| Naji, M. |
| |
| Motta, Antonella |
| |
| Aletan, Dirar |
| |
| Mohamed, Tarek |
| |
| Ertürk, Emre |
| |
| Taccardi, Nicola |
| |
| Kononenko, Denys |
| |
| Petrov, R. H. | Madrid |
|
| Alshaaer, Mazen | Brussels |
|
| Bih, L. |
| |
| Casati, R. |
| |
| Muller, Hermance |
| |
| Kočí, Jan | Prague |
|
| Šuljagić, Marija |
| |
| Kalteremidou, Kalliopi-Artemi | Brussels |
|
| Azam, Siraj |
| |
| Ospanova, Alyiya |
| |
| Blanpain, Bart |
| |
| Ali, M. A. |
| |
| Popa, V. |
| |
| Rančić, M. |
| |
| Ollier, Nadège |
| |
| Azevedo, Nuno Monteiro |
| |
| Landes, Michael |
| |
| Rignanese, Gian-Marco |
|
Silva, Amt
in Cooperation with on an Cooperation-Score of 37%
Topics
Publications (12/12 displayed)
- 2023Pd and Pd-Cu supported on different carbon materials and immobilized as flow-through catalytic membranes for the chemical reduction of NO3-, NO-2 and BrO3- in drinking water treatmentcitations
- 2017Comparison of self-standing and supported graphene oxide membranes prepared by simple filtration: Gas and vapor separation, pore structure and stabilitycitations
- 2016Reduced graphene oxide catalysts for efficient regeneration of cobalt-based redox electrolytes in dye-sensitized solar cellscitations
- 2015Synergistic effect between carbon nanomaterials and ZnO for photocatalytic water decontaminationcitations
- 2014Pore structure, interface properties and photocatalytic efficiency of hydration/dehydration derived TiO2/CNT compositescitations
- 2014Azo-dye orange II degradation by the heterogeneous Fenton-like process using a zeolite Y-Fe catalyst-Kinetics with a model based on the Fermi's equationcitations
- 2014Controlled surface functionalization of multiwall carbon nanotubes by HNO3 hydrothermal oxidationcitations
- 2013CERAMIC MEMBRANES IN HYBRID PHOTOCATALYSIS/ULTRAFILTRATION PROCESSES
- 2012Insights into UV-TiO2 photocatalytic degradation of PCE for air decontamination systemscitations
- 2012Preparation of carbon aerogel supported platinum catalysts for the selective hydrogenation of cinnamaldehydecitations
- 2012Advanced nanostructured photocatalysts based on reduced graphene oxide-TiO2 composites for degradation of diphenhydramine pharmaceutical and methyl orange dyecitations
- 2011Carbon nanotube-TiO2 thin films for photocatalytic applicationscitations
Places of action
| Organizations | Location | People |
|---|
article
Reduced graphene oxide catalysts for efficient regeneration of cobalt-based redox electrolytes in dye-sensitized solar cells
Abstract
Efficient and low cost reduced graphene oxide (rGOV) is prepared by chemical reduction of graphene oxide (GO) using vitamin C. Detailed characterization by XRD, SEM and Raman techniques confirm the successful reduction of GO. Thin films of rGOV with various thickness are deposited by spin coating on FTO glass substrates and are used as counter electrodes (CEs) in dye-sensitized solar cells (DSCs) incorporating the organic sensitizer D35 dye and the Co(bpy)(3)(3+)/Co(bpy)(3)(2+) redox couple. These devices present high photocurrent density (j(sc)) and open-circuit voltage (V-oc) values resulting in enhanced photovoltaic performance in comparison with the Pt catalyst. The novel rGOV electrodes constitute an excellent, low-cost and environmentally friendly alternative solution to the costly platinum-based cathodes.